About [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate
[(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate (PubChem CID 69420669) has the molecular formula C28H26BCl2NO3
and a molecular weight of 506.24 g/mol. Its IUPAC name is [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate.
Molecular Properties
| Compound Name | [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate |
| PubChem CID | 69420669 |
| Molecular Formula | C28H26BCl2NO3 |
| Molecular Weight | 506.24 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate |
| SMILES | Cc1ccc(OB(Oc2ccc(C)c(Cl)c2)O[C@H](c2ccccc2)[C@H](N)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C28H26BCl2NO3/c1-19-13-15-23(17-25(19)30)33-29(34-24-16-14-20(2)26(31)18-24)35-28(22-11-7-4-8-12-22)27(32)21-9-5-3-6-10-21/h3-18,27-28H,32H2,1-2H3/t27-,28-/m1/s1 |
| InChIKey | OUJVZSJKCYPZHX-VSGBNLITSA-N |
| XLogP | 7.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.24 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate?
The IUPAC name of [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate (CID 69420669) is [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate.
What is the SMILES notation for [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate?
The canonical SMILES for [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate is Cc1ccc(OB(Oc2ccc(C)c(Cl)c2)O[C@H](c2ccccc2)[C@H](N)c2ccccc2)cc1Cl.
What is the InChIKey of [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate?
The InChIKey is OUJVZSJKCYPZHX-VSGBNLITSA-N. The full InChI is InChI=1S/C28H26BCl2NO3/c1-19-13-15-23(17-25(19)30)33-29(34-24-16-14-20(2)26(31)18-24)35-28(22-11-7-4-8-12-22)27(32)21-9-5-3-6-10-21/h3-18,27-28H,32H2,1-2H3/t27-,28-/m1/s1.
What are the key properties of [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate?
[(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate has a molecular weight of 506.24 g/mol, XLogP of 7.51, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-amino-1,2-diphenylethyl] bis(3-chloro-4-methylphenyl) borate is sourced from PubChem (CID 69420669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).