C15H19BrN2O2S — CID 69421905
2-[2-(2,6-dimethoxyphenyl)ethenyl]-3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium bromide (PubChem CID 69421905) has the molecular formula C15H19BrN2O2S and a molecular weight of 371.30 g/mol. Its IUPAC name is 2-[2-(2,6-dimethoxyphenyl)ethenyl]-3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium bromide.
| Compound Name | 2-[2-(2,6-dimethoxyphenyl)ethenyl]-3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium bromide |
|---|---|
| PubChem CID | 69421905 |
| Molecular Formula | C15H19BrN2O2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-[2-(2,6-dimethoxyphenyl)ethenyl]-3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium bromide |
| SMILES | CC[n+]1nc(C)sc1C=Cc1c(OC)cccc1OC.[Br-] |
| InChI | InChI=1S/C15H19N2O2S.BrH/c1-5-17-15(20-11(2)16-17)10-9-12-13(18-3)7-6-8-14(12)19-4;/h6-10H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HOQRYARMAUTTFA-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|