About 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide
3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide (PubChem CID 69421911) has the molecular formula C14H17BrN2O2S
and a molecular weight of 357.27 g/mol. Its IUPAC name is 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide.
Molecular Properties
| Compound Name | 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide |
| PubChem CID | 69421911 |
| Molecular Formula | C14H17BrN2O2S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide |
| SMILES | CC[n+]1nc(C)sc1C=Cc1cc(O)cc(OC)c1.[Br-] |
| InChI | InChI=1S/C14H16N2O2S.BrH/c1-4-16-14(19-10(2)15-16)6-5-11-7-12(17)9-13(8-11)18-3;/h5-9H,4H2,1-3H3;1H |
| InChIKey | QCSBWYHPFJKIIY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 46.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide?
The IUPAC name of 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide (CID 69421911) is 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide.
What is the SMILES notation for 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide?
The canonical SMILES for 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide is CC[n+]1nc(C)sc1C=Cc1cc(O)cc(OC)c1.[Br-].
What is the InChIKey of 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide?
The InChIKey is QCSBWYHPFJKIIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S.BrH/c1-4-16-14(19-10(2)15-16)6-5-11-7-12(17)9-13(8-11)18-3;/h5-9H,4H2,1-3H3;1H.
What are the key properties of 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide?
3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide has a molecular weight of 357.27 g/mol, XLogP of -0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-ethyl-5-methyl-1,3,4-thiadiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol bromide is sourced from PubChem (CID 69421911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).