C33H42F5N3O7S — CID 69421957
[(2R,3S)-3-[(2-amino-3-heptan-4-ylsulfonylpropanoyl)-phenylmethoxycarbonylamino]-1-(cyclopropylamino)-4-(3,5-difluorophenyl)butan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 69421957) has the molecular formula C33H42F5N3O7S and a molecular weight of 719.77 g/mol. Its IUPAC name is [(2R,3S)-3-[(2-amino-3-heptan-4-ylsulfonylpropanoyl)-phenylmethoxycarbonylamino]-1-(cyclopropylamino)-4-(3,5-difluorophenyl)butan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3S)-3-[(2-amino-3-heptan-4-ylsulfonylpropanoyl)-phenylmethoxycarbonylamino]-1-(cyclopropylamino)-4-(3,5-difluorophenyl)butan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69421957 |
| Molecular Formula | C33H42F5N3O7S |
| Molecular Weight | 719.77 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | [(2R,3S)-3-[(2-amino-3-heptan-4-ylsulfonylpropanoyl)-phenylmethoxycarbonylamino]-1-(cyclopropylamino)-4-(3,5-difluorophenyl)butan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CCCC(CCC)S(=O)(=O)CC(N)C(=O)N(C(=O)OCc1ccccc1)[C@@H](Cc1cc(F)cc(F)c1)[C@@H](CNC1CC1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C33H42F5N3O7S/c1-3-8-26(9-4-2)49(45,46)20-27(39)30(42)41(32(44)47-19-21-10-6-5-7-11-21)28(16-22-14-23(34)17-24(35)15-22)29(18-40-25-12-13-25)48-31(43)33(36,37)38/h5-7,10-11,14-15,17,25-29,40H,3-4,8-9,12-13,16,18-20,39H2,1-2H3/t27?,28-,29+/m0/s1 |
| InChIKey | UYXQKJIVKHKBPZ-CVWZLOPKSA-N |
| XLogP | 4.98 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.77 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |