C18H29N9 — CID 69422026
(3S,5R)-1-[6-amino-3-[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoxalin-2-yl]piperidine-3,5-diamine (PubChem CID 69422026) has the molecular formula C18H29N9 and a molecular weight of 371.49 g/mol. Its IUPAC name is (3S,5R)-1-[6-amino-3-[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoxalin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3S,5R)-1-[6-amino-3-[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoxalin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 69422026 |
| Molecular Formula | C18H29N9 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (3S,5R)-1-[6-amino-3-[(3S,5R)-3,5-diaminopiperidin-1-yl]quinoxalin-2-yl]piperidine-3,5-diamine |
| SMILES | Nc1ccc2nc(N3C[C@H](N)C[C@H](N)C3)c(N3C[C@H](N)C[C@H](N)C3)nc2c1 |
| InChI | InChI=1S/C18H29N9/c19-10-1-2-15-16(5-10)25-18(27-8-13(22)4-14(23)9-27)17(24-15)26-6-11(20)3-12(21)7-26/h1-2,5,11-14H,3-4,6-9,19-23H2/t11-,12+,13-,14+ |
| InChIKey | TYMDTILWWRZNDP-KPWCQOOUSA-N |
| XLogP | -1.06 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|