C25H22FN3O — CID 69422306
3-(4-fluorophenyl)-1-(oxan-2-yl)-5-(2-pyridin-2-ylethenyl)indazole (PubChem CID 69422306) has the molecular formula C25H22FN3O and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(oxan-2-yl)-5-(2-pyridin-2-ylethenyl)indazole.
| Compound Name | 3-(4-fluorophenyl)-1-(oxan-2-yl)-5-(2-pyridin-2-ylethenyl)indazole |
|---|---|
| PubChem CID | 69422306 |
| Molecular Formula | C25H22FN3O |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(oxan-2-yl)-5-(2-pyridin-2-ylethenyl)indazole |
| SMILES | Fc1ccc(-c2nn(C3CCCCO3)c3ccc(C=Cc4ccccn4)cc23)cc1 |
| InChI | InChI=1S/C25H22FN3O/c26-20-11-9-19(10-12-20)25-22-17-18(7-13-21-5-1-3-15-27-21)8-14-23(22)29(28-25)24-6-2-4-16-30-24/h1,3,5,7-15,17,24H,2,4,6,16H2 |
| InChIKey | PGKYRRWFCDCLOP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |