C10H11F3N6O2 — CID 69422521
[3-amino-1-(5H-imidazo[4,5-c]pyridazin-6-ylamino)propyl] 2,2,2-trifluoroacetate (PubChem CID 69422521) has the molecular formula C10H11F3N6O2 and a molecular weight of 304.23 g/mol. Its IUPAC name is [3-amino-1-(5H-imidazo[4,5-c]pyridazin-6-ylamino)propyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-amino-1-(5H-imidazo[4,5-c]pyridazin-6-ylamino)propyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69422521 |
| Molecular Formula | C10H11F3N6O2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [3-amino-1-(5H-imidazo[4,5-c]pyridazin-6-ylamino)propyl] 2,2,2-trifluoroacetate |
| SMILES | NCCC(Nc1nc2nnccc2[nH]1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N6O2/c11-10(12,13)8(20)21-6(1-3-14)17-9-16-5-2-4-15-19-7(5)18-9/h2,4,6H,1,3,14H2,(H2,16,17,18,19) |
| InChIKey | YXPDVZAJOGBMJU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|