About 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid
3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid (PubChem CID 69422557) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid |
| PubChem CID | 69422557 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid |
| SMILES | O=C(O)N1CCn2c(cc3ccccc32)C1 |
| InChI | InChI=1S/C12H12N2O2/c15-12(16)13-5-6-14-10(8-13)7-9-3-1-2-4-11(9)14/h1-4,7H,5-6,8H2,(H,15,16) |
| InChIKey | OBALHPQJMUDKCR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid?
The IUPAC name of 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid (CID 69422557) is 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid.
What is the SMILES notation for 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid?
The canonical SMILES for 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid is O=C(O)N1CCn2c(cc3ccccc32)C1.
What is the InChIKey of 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid?
The InChIKey is OBALHPQJMUDKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-12(16)13-5-6-14-10(8-13)7-9-3-1-2-4-11(9)14/h1-4,7H,5-6,8H2,(H,15,16).
What are the key properties of 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid?
3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid has a molecular weight of 216.24 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylic acid is sourced from PubChem (CID 69422557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).