C16H21N2O3S+ — CID 69422564
3-ethyl-5-methyl-2-[2-(2,3,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium (PubChem CID 69422564) has the molecular formula C16H21N2O3S+ and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-ethyl-5-methyl-2-[2-(2,3,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium.
| Compound Name | 3-ethyl-5-methyl-2-[2-(2,3,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium |
|---|---|
| PubChem CID | 69422564 |
| Molecular Formula | C16H21N2O3S+ |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3-ethyl-5-methyl-2-[2-(2,3,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-3-ium |
| SMILES | CC[n+]1nc(C)sc1C=Cc1cc(OC)cc(OC)c1OC |
| InChI | InChI=1S/C16H21N2O3S/c1-6-18-15(22-11(2)17-18)8-7-12-9-13(19-3)10-14(20-4)16(12)21-5/h7-10H,6H2,1-5H3/q+1 |
| InChIKey | BTQPQHKHSQFXLB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|