C24H21FN2O2 — CID 69423063
[3-(4-fluorophenyl)-1-[(4-phenylmethoxyphenyl)methyl]pyrazol-4-yl]methanol (PubChem CID 69423063) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1-[(4-phenylmethoxyphenyl)methyl]pyrazol-4-yl]methanol.
| Compound Name | [3-(4-fluorophenyl)-1-[(4-phenylmethoxyphenyl)methyl]pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 69423063 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [3-(4-fluorophenyl)-1-[(4-phenylmethoxyphenyl)methyl]pyrazol-4-yl]methanol |
| SMILES | OCc1cn(Cc2ccc(OCc3ccccc3)cc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN2O2/c25-22-10-8-20(9-11-22)24-21(16-28)15-27(26-24)14-18-6-12-23(13-7-18)29-17-19-4-2-1-3-5-19/h1-13,15,28H,14,16-17H2 |
| InChIKey | ONDXJEYGLYHVSO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |