About 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine
9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine (PubChem CID 69423330) has the molecular formula C21H17ClF2N4
and a molecular weight of 398.84 g/mol. Its IUPAC name is 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine.
Molecular Properties
| Compound Name | 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine |
| PubChem CID | 69423330 |
| Molecular Formula | C21H17ClF2N4 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine |
| SMILES | CC(C)(C)n1c(-c2ccccc2Cl)nc2cnc(-c3c(F)cccc3F)nc21 |
| InChI | InChI=1S/C21H17ClF2N4/c1-21(2,3)28-19(12-7-4-5-8-13(12)22)26-16-11-25-18(27-20(16)28)17-14(23)9-6-10-15(17)24/h4-11H,1-3H3 |
| InChIKey | BSBAOVHAQDRIMB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine?
The IUPAC name of 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine (CID 69423330) is 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine.
What is the SMILES notation for 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine?
The canonical SMILES for 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine is CC(C)(C)n1c(-c2ccccc2Cl)nc2cnc(-c3c(F)cccc3F)nc21.
What is the InChIKey of 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine?
The InChIKey is BSBAOVHAQDRIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClF2N4/c1-21(2,3)28-19(12-7-4-5-8-13(12)22)26-16-11-25-18(27-20(16)28)17-14(23)9-6-10-15(17)24/h4-11H,1-3H3.
What are the key properties of 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine?
9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine has a molecular weight of 398.84 g/mol, XLogP of 5.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-tert-butyl-8-(2-chlorophenyl)-2-(2,6-difluorophenyl)purine is sourced from PubChem (CID 69423330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).