C27H38N10O — CID 69423563
(1S,2R)-2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-1,2-diphenylethanol (PubChem CID 69423563) has the molecular formula C27H38N10O and a molecular weight of 518.67 g/mol. Its IUPAC name is (1S,2R)-2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-1,2-diphenylethanol.
| Compound Name | (1S,2R)-2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 69423563 |
| Molecular Formula | C27H38N10O |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (1S,2R)-2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-1,2-diphenylethanol |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(N[C@H](c3ccccc3)[C@@H](O)c3ccccc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C27H38N10O/c28-19-11-20(29)14-36(13-19)26-33-25(34-27(35-26)37-15-21(30)12-22(31)16-37)32-23(17-7-3-1-4-8-17)24(38)18-9-5-2-6-10-18/h1-10,19-24,38H,11-16,28-31H2,(H,32,33,34,35)/t19-,20+,21-,22+,23-,24+/m1/s1 |
| InChIKey | KXBKMQYIMXGDJQ-MIYXWFHDSA-N |
| XLogP | 0.49 |
| TPSA | 181.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |