C22H36ClN11O3S — CID 69423656
N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloropropane-1-sulfonamide (PubChem CID 69423656) has the molecular formula C22H36ClN11O3S and a molecular weight of 570.12 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloropropane-1-sulfonamide.
| Compound Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloropropane-1-sulfonamide |
|---|---|
| PubChem CID | 69423656 |
| Molecular Formula | C22H36ClN11O3S |
| Molecular Weight | 570.12 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloropropane-1-sulfonamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NS(=O)(=O)CCCCl)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C22H36ClN11O3S/c23-4-1-5-38(36,37)32-18-3-2-17(8-19(18)35)28-20-29-21(33-9-13(24)6-14(25)10-33)31-22(30-20)34-11-15(26)7-16(27)12-34/h2-3,8,13-16,32,35H,1,4-7,9-12,24-27H2,(H,28,29,30,31)/t13-,14+,15-,16+ |
| InChIKey | MSDRQYLRIMDBJD-GEEKYZPCSA-N |
| XLogP | -0.58 |
| TPSA | 227.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.12 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|