C22H18N4O3 — CID 69423690
6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylic acid (PubChem CID 69423690) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylic acid.
| Compound Name | 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 69423690 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2c(ccc3c2ccn3C(=O)C2Cc3c(ccc4[nH]ccc34)N2)N1 |
| InChI | InChI=1S/C22H18N4O3/c27-21(18-9-13-11-5-7-23-15(11)1-2-16(13)24-18)26-8-6-12-14-10-19(22(28)29)25-17(14)3-4-20(12)26/h1-8,18-19,23-25H,9-10H2,(H,28,29) |
| InChIKey | CMZDTGZBAWVUOE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |