C20H25N5O5S2 — CID 69423886
3-[(2S,3S)-2-hydroxy-4-phenyl-3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]butanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 69423886) has the molecular formula C20H25N5O5S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-[(2S,3S)-2-hydroxy-4-phenyl-3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]butanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[(2S,3S)-2-hydroxy-4-phenyl-3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]butanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 69423886 |
| Molecular Formula | C20H25N5O5S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 3-[(2S,3S)-2-hydroxy-4-phenyl-3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]butanoyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SCN(C(=O)[C@@H](O)[C@H](Cc2ccccc2)NC(=O)CSc2ncn[nH]2)C1C(=O)O |
| InChI | InChI=1S/C20H25N5O5S2/c1-20(2)16(18(29)30)25(11-32-20)17(28)15(27)13(8-12-6-4-3-5-7-12)23-14(26)9-31-19-21-10-22-24-19/h3-7,10,13,15-16,27H,8-9,11H2,1-2H3,(H,23,26)(H,29,30)(H,21,22,24)/t13-,15-,16?/m0/s1 |
| InChIKey | VIKNLNWCEHEXBQ-JFXOEICMSA-N |
| XLogP | 0.75 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |