C33H29NO3 — CID 69423915
2-[[4-phenyl-1-[(6-phenylmethoxynaphthalen-2-yl)methyl]pyrrol-3-yl]methylidene]butanoic acid (PubChem CID 69423915) has the molecular formula C33H29NO3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[[4-phenyl-1-[(6-phenylmethoxynaphthalen-2-yl)methyl]pyrrol-3-yl]methylidene]butanoic acid.
| Compound Name | 2-[[4-phenyl-1-[(6-phenylmethoxynaphthalen-2-yl)methyl]pyrrol-3-yl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 69423915 |
| Molecular Formula | C33H29NO3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-[[4-phenyl-1-[(6-phenylmethoxynaphthalen-2-yl)methyl]pyrrol-3-yl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cn(Cc2ccc3cc(OCc4ccccc4)ccc3c2)cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H29NO3/c1-2-26(33(35)36)18-30-21-34(22-32(30)27-11-7-4-8-12-27)20-25-13-14-29-19-31(16-15-28(29)17-25)37-23-24-9-5-3-6-10-24/h3-19,21-22H,2,20,23H2,1H3,(H,35,36) |
| InChIKey | SPQFUVHVZVLXPJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|