About 2-(methylamino)benzoate
2-(methylamino)benzoate (PubChem CID 6942392) has the molecular formula C8H8NO2-
and a molecular weight of 150.16 g/mol. Its IUPAC name is 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | 2-(methylamino)benzoate |
| PubChem CID | 6942392 |
| Molecular Formula | C8H8NO2- |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H9NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h2-5,9H,1H3,(H,10,11)/p-1 |
| InChIKey | WVMBPWMAQDVZCM-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)benzoate?
The IUPAC name of 2-(methylamino)benzoate (CID 6942392) is 2-(methylamino)benzoate.
What is the SMILES notation for 2-(methylamino)benzoate?
The canonical SMILES for 2-(methylamino)benzoate is CNc1ccccc1C(=O)[O-].
What is the InChIKey of 2-(methylamino)benzoate?
The InChIKey is WVMBPWMAQDVZCM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h2-5,9H,1H3,(H,10,11)/p-1.
What are the key properties of 2-(methylamino)benzoate?
2-(methylamino)benzoate has a molecular weight of 150.16 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)benzoate is sourced from PubChem (CID 6942392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).