About 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone
1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone (PubChem CID 69424274) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone |
| PubChem CID | 69424274 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone |
| SMILES | CC(=O)N1CCc2ncc(N)cc2C1 |
| InChI | InChI=1S/C10H13N3O/c1-7(14)13-3-2-10-8(6-13)4-9(11)5-12-10/h4-5H,2-3,6,11H2,1H3 |
| InChIKey | JJKWGOBARRYBKN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone?
The IUPAC name of 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone (CID 69424274) is 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone.
What is the SMILES notation for 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone?
The canonical SMILES for 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone is CC(=O)N1CCc2ncc(N)cc2C1.
What is the InChIKey of 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone?
The InChIKey is JJKWGOBARRYBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-7(14)13-3-2-10-8(6-13)4-9(11)5-12-10/h4-5H,2-3,6,11H2,1H3.
What are the key properties of 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone?
1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone has a molecular weight of 191.23 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-7,8-dihydro-5H-1,6-naphthyridin-6-yl)ethanone is sourced from PubChem (CID 69424274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).