C21H28N4O3S2 — CID 69424579
N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-(thiophen-3-ylsulfonylmethylamino)butanamide (PubChem CID 69424579) has the molecular formula C21H28N4O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-(thiophen-3-ylsulfonylmethylamino)butanamide.
| Compound Name | N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-(thiophen-3-ylsulfonylmethylamino)butanamide |
|---|---|
| PubChem CID | 69424579 |
| Molecular Formula | C21H28N4O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-(thiophen-3-ylsulfonylmethylamino)butanamide |
| SMILES | CN(CCc1ccc(C2=NCCN2)cc1)C(=O)CCCNCS(=O)(=O)c1ccsc1 |
| InChI | InChI=1S/C21H28N4O3S2/c1-25(13-8-17-4-6-18(7-5-17)21-23-11-12-24-21)20(26)3-2-10-22-16-30(27,28)19-9-14-29-15-19/h4-7,9,14-15,22H,2-3,8,10-13,16H2,1H3,(H,23,24) |
| InChIKey | WAGCQBOKEHKNEI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|