C23H20N4O3 — CID 69424768
methyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 69424768) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is methyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | methyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 69424768 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl 6-(1,2,3,6-tetrahydropyrrolo[3,2-e]indole-2-carbonyl)-2,3-dihydro-1H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC(=O)C1Cc2c(ccc3c2ccn3C(=O)C2Cc3c(ccc4[nH]ccc34)N2)N1 |
| InChI | InChI=1S/C23H20N4O3/c1-30-23(29)20-11-15-13-7-9-27(21(13)5-4-18(15)26-20)22(28)19-10-14-12-6-8-24-16(12)2-3-17(14)25-19/h2-9,19-20,24-26H,10-11H2,1H3 |
| InChIKey | OGPVQKSEQRHMKY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |