C15H23N3 — CID 69425044
3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)phenyl]propan-1-amine (PubChem CID 69425044) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)phenyl]propan-1-amine.
| Compound Name | 3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 69425044 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)phenyl]propan-1-amine |
| SMILES | NCCCc1cccc(N2CC3CNCC3C2)c1 |
| InChI | InChI=1S/C15H23N3/c16-6-2-4-12-3-1-5-15(7-12)18-10-13-8-17-9-14(13)11-18/h1,3,5,7,13-14,17H,2,4,6,8-11,16H2 |
| InChIKey | PGOANFLNJCKCKD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |