C20H20ClF3N2O2 — CID 69425126
9-chloro-2-cyclopropyl-4-(3,4-dimethoxyphenyl)-2,3,3-trifluoro-7-methyl-4H-pyrido[1,2-a]pyrimidine (PubChem CID 69425126) has the molecular formula C20H20ClF3N2O2 and a molecular weight of 412.84 g/mol. Its IUPAC name is 9-chloro-2-cyclopropyl-4-(3,4-dimethoxyphenyl)-2,3,3-trifluoro-7-methyl-4H-pyrido[1,2-a]pyrimidine.
| Compound Name | 9-chloro-2-cyclopropyl-4-(3,4-dimethoxyphenyl)-2,3,3-trifluoro-7-methyl-4H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 69425126 |
| Molecular Formula | C20H20ClF3N2O2 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 9-chloro-2-cyclopropyl-4-(3,4-dimethoxyphenyl)-2,3,3-trifluoro-7-methyl-4H-pyrido[1,2-a]pyrimidine |
| SMILES | COc1ccc(C2N3C=C(C)C=C(Cl)C3=NC(F)(C3CC3)C2(F)F)cc1OC |
| InChI | InChI=1S/C20H20ClF3N2O2/c1-11-8-14(21)18-25-20(24,13-5-6-13)19(22,23)17(26(18)10-11)12-4-7-15(27-2)16(9-12)28-3/h4,7-10,13,17H,5-6H2,1-3H3 |
| InChIKey | GBOVXSVNOMNNCC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|