C12H4Cl4O4 — CID 69425131
cyclohexa-2,5-diene-1,4-dione;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione (PubChem CID 69425131) has the molecular formula C12H4Cl4O4 and a molecular weight of 353.97 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 69425131 |
| Molecular Formula | C12H4Cl4O4 |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6Cl4O2.C6H4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11;7-5-1-2-6(8)4-3-5/h;1-4H |
| InChIKey | LGJNZLBIXCKQHN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|