C15H33N3 — CID 69425142
1-N,2-N,4-N-tripropylcyclohexane-1,2,4-triamine (PubChem CID 69425142) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-N,2-N,4-N-tripropylcyclohexane-1,2,4-triamine.
| Compound Name | 1-N,2-N,4-N-tripropylcyclohexane-1,2,4-triamine |
|---|---|
| PubChem CID | 69425142 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 1-N,2-N,4-N-tripropylcyclohexane-1,2,4-triamine |
| SMILES | CCCNC1CCC(NCCC)C(NCCC)C1 |
| InChI | InChI=1S/C15H33N3/c1-4-9-16-13-7-8-14(17-10-5-2)15(12-13)18-11-6-3/h13-18H,4-12H2,1-3H3 |
| InChIKey | XOWSDAQBUCZMKC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |