C10H14N4 — CID 69425172
2-(6,7,8,8a-tetrahydroquinolin-2-yl)guanidine (PubChem CID 69425172) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(6,7,8,8a-tetrahydroquinolin-2-yl)guanidine.
| Compound Name | 2-(6,7,8,8a-tetrahydroquinolin-2-yl)guanidine |
|---|---|
| PubChem CID | 69425172 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-(6,7,8,8a-tetrahydroquinolin-2-yl)guanidine |
| SMILES | NC(N)=NC1=NC2CCCC=C2C=C1 |
| InChI | InChI=1S/C10H14N4/c11-10(12)14-9-6-5-7-3-1-2-4-8(7)13-9/h3,5-6,8H,1-2,4H2,(H4,11,12,13,14) |
| InChIKey | SHYCCWDMSZPHBZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|