About N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine
N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine (PubChem CID 69425325) has the molecular formula C19H24F2N2
and a molecular weight of 318.41 g/mol. Its IUPAC name is N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine.
Molecular Properties
| Compound Name | N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine |
| PubChem CID | 69425325 |
| Molecular Formula | C19H24F2N2 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine |
| SMILES | Fc1cc(F)c2[nH]cc(CCCN(C3CCC3)C3CCC3)c2c1 |
| InChI | InChI=1S/C19H24F2N2/c20-14-10-17-13(12-22-19(17)18(21)11-14)4-3-9-23(15-5-1-6-15)16-7-2-8-16/h10-12,15-16,22H,1-9H2 |
| InChIKey | VEDMVBCDPQCPRR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine?
The IUPAC name of N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine (CID 69425325) is N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine.
What is the SMILES notation for N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine?
The canonical SMILES for N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine is Fc1cc(F)c2[nH]cc(CCCN(C3CCC3)C3CCC3)c2c1.
What is the InChIKey of N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine?
The InChIKey is VEDMVBCDPQCPRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N2/c20-14-10-17-13(12-22-19(17)18(21)11-14)4-3-9-23(15-5-1-6-15)16-7-2-8-16/h10-12,15-16,22H,1-9H2.
What are the key properties of N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine?
N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine has a molecular weight of 318.41 g/mol, XLogP of 4.79, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-N-[3-(5,7-difluoro-1H-indol-3-yl)propyl]cyclobutanamine is sourced from PubChem (CID 69425325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).