C41H44F2N12O7 — CID 69425340
bis[2-fluoro-3-[(3R)-3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]phenyl]methanone (PubChem CID 69425340) has the molecular formula C41H44F2N12O7 and a molecular weight of 854.88 g/mol. Its IUPAC name is bis[2-fluoro-3-[(3R)-3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]phenyl]methanone.
| Compound Name | bis[2-fluoro-3-[(3R)-3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 69425340 |
| Molecular Formula | C41H44F2N12O7 |
| Molecular Weight | 854.88 g/mol |
| Exact Mass | 854.34 |
| IUPAC Name | bis[2-fluoro-3-[(3R)-3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]phenyl]methanone |
| SMILES | O=C(c1cccc(N2CC[C@@H](Nc3ncnc4c3ncn4[C@@H]3O[C@H](CO)C[C@H]3O)C2)c1F)c1cccc(N2CC[C@@H](Nc3ncnc4c3ncn4[C@@H]3O[C@H](CO)C[C@H]3O)C2)c1F |
| InChI | InChI=1S/C41H44F2N12O7/c42-31-25(3-1-5-27(31)52-9-7-21(13-52)50-36-33-38(46-17-44-36)54(19-48-33)40-29(58)11-23(15-56)61-40)35(60)26-4-2-6-28(32(26)43)53-10-8-22(14-53)51-37-34-39(47-18-45-37)55(20-49-34)41-30(59)12-24(16-57)62-41/h1-6,17-24,29-30,40-41,56-59H,7-16H2,(H,44,46,50)(H,45,47,51)/t21-,22-,23+,24+,29-,30-,40-,41-/m1/s1 |
| InChIKey | DUDKIDWCVLVXAJ-ZHEKLMNMSA-N |
| XLogP | 2.14 |
| TPSA | 234.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |