About 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid
4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid (PubChem CID 69425349) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid |
| PubChem CID | 69425349 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)C1=CCN2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H8N2O2/c12-9(13)7-4-6-11-5-2-1-3-8(11)10-7/h1-5H,6H2,(H,12,13) |
| InChIKey | WXMLNSBINBLHPM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
The IUPAC name of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid (CID 69425349) is 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid.
What is the SMILES notation for 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
The canonical SMILES for 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid is O=C(O)C1=CCN2C=CC=CC2=N1.
What is the InChIKey of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
The InChIKey is WXMLNSBINBLHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-9(13)7-4-6-11-5-2-1-3-8(11)10-7/h1-5H,6H2,(H,12,13).
What are the key properties of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid has a molecular weight of 176.17 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid is sourced from PubChem (CID 69425349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).