4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid

C9H8N2O2 — CID 69425349

IUPAC4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid
SMILESO=C(O)C1=CCN2C=CC=CC2=N1
InChIInChI=1S/C9H8N2O2/c12-9(13)7-4-6-11-5-2-1-3-8(11)10-7/h1-5H,6H2,(H,12,13)
InChIKeyWXMLNSBINBLHPM-UHFFFAOYSA-N
MW176.17 g/mol
LogP0.75
Rot. Bonds1

About 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid

4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid (PubChem CID 69425349) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid.

Molecular Properties

Compound Name4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid
PubChem CID69425349
Molecular FormulaC9H8N2O2
Molecular Weight176.17 g/mol
Exact Mass176.06
IUPAC Name4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid
SMILESO=C(O)C1=CCN2C=CC=CC2=N1
InChIInChI=1S/C9H8N2O2/c12-9(13)7-4-6-11-5-2-1-3-8(11)10-7/h1-5H,6H2,(H,12,13)
InChIKeyWXMLNSBINBLHPM-UHFFFAOYSA-N
XLogP0.75
TPSA52.90 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
The IUPAC name of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid (CID 69425349) is 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid.
What is the SMILES notation for 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
The canonical SMILES for 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid is O=C(O)C1=CCN2C=CC=CC2=N1.
What is the InChIKey of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
The InChIKey is WXMLNSBINBLHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-9(13)7-4-6-11-5-2-1-3-8(11)10-7/h1-5H,6H2,(H,12,13).
What are the key properties of 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid?
4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid has a molecular weight of 176.17 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[1,2-a]pyrimidine-2-carboxylic acid is sourced from PubChem (CID 69425349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).