C19H34N10O2 — CID 69425487
1-[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3-carboxylic acid (PubChem CID 69425487) has the molecular formula C19H34N10O2 and a molecular weight of 434.55 g/mol. Its IUPAC name is 1-[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69425487 |
| Molecular Formula | C19H34N10O2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 1-[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3-carboxylic acid |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(N3CCCC(C(=O)O)C3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C19H34N10O2/c20-12-4-13(21)8-28(7-12)18-24-17(27-3-1-2-11(6-27)16(30)31)25-19(26-18)29-9-14(22)5-15(23)10-29/h11-15H,1-10,20-23H2,(H,30,31)/t11?,12-,13+,14-,15+ |
| InChIKey | NMTIIXLBNMDBKB-LFAHVKQVSA-N |
| XLogP | -2.10 |
| TPSA | 189.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |