About 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol
1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol (PubChem CID 69425854) has the molecular formula C23H30O3
and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol.
Molecular Properties
| Compound Name | 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol |
| PubChem CID | 69425854 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol |
| SMILES | C=Cc1ccc(OC(OCCC)C(C)C)cc1.C=Cc1ccccc1O |
| InChI | InChI=1S/C15H22O2.C8H8O/c1-5-11-16-15(12(3)4)17-14-9-7-13(6-2)8-10-14;1-2-7-5-3-4-6-8(7)9/h6-10,12,15H,2,5,11H2,1,3-4H3;2-6,9H,1H2 |
| InChIKey | WYCZMQAAQCDOBI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol?
The IUPAC name of 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol (CID 69425854) is 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol.
What is the SMILES notation for 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol?
The canonical SMILES for 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol is C=Cc1ccc(OC(OCCC)C(C)C)cc1.C=Cc1ccccc1O.
What is the InChIKey of 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol?
The InChIKey is WYCZMQAAQCDOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2.C8H8O/c1-5-11-16-15(12(3)4)17-14-9-7-13(6-2)8-10-14;1-2-7-5-3-4-6-8(7)9/h6-10,12,15H,2,5,11H2,1,3-4H3;2-6,9H,1H2.
What are the key properties of 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol?
1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol has a molecular weight of 354.49 g/mol, XLogP of 6.15, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-(2-methyl-1-propoxypropoxy)benzene;2-ethenylphenol is sourced from PubChem (CID 69425854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).