C18H21Cl2NO3 — CID 69425875
ethyl 2-(3,3-dichloro-1-propyl-4,9-dihydropyrano[3,4-b]indol-1-yl)acetate (PubChem CID 69425875) has the molecular formula C18H21Cl2NO3 and a molecular weight of 370.28 g/mol. Its IUPAC name is ethyl 2-(3,3-dichloro-1-propyl-4,9-dihydropyrano[3,4-b]indol-1-yl)acetate.
| Compound Name | ethyl 2-(3,3-dichloro-1-propyl-4,9-dihydropyrano[3,4-b]indol-1-yl)acetate |
|---|---|
| PubChem CID | 69425875 |
| Molecular Formula | C18H21Cl2NO3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl 2-(3,3-dichloro-1-propyl-4,9-dihydropyrano[3,4-b]indol-1-yl)acetate |
| SMILES | CCCC1(CC(=O)OCC)OC(Cl)(Cl)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C18H21Cl2NO3/c1-3-9-17(11-15(22)23-4-2)16-13(10-18(19,20)24-17)12-7-5-6-8-14(12)21-16/h5-8,21H,3-4,9-11H2,1-2H3 |
| InChIKey | HGWAJHYSJRJVTO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|