C22H30O2 — CID 69426135
styrene;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 69426135) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is styrene;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | styrene;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 69426135 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | styrene;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C.C=Cc1ccccc1 |
| InChI | InChI=1S/C14H22O2.C8H8/c1-9(2)12(15)16-11-8-10-6-7-14(11,5)13(10,3)4;1-2-8-6-4-3-5-7-8/h10-11H,1,6-8H2,2-5H3;2-7H,1H2/t10-,11-,14+;/m0./s1 |
| InChIKey | UEMBLTWULNNCPL-ZVACWDIYSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|