C27H31FN2O4 — CID 69426695
3-[cyclobutyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 69426695) has the molecular formula C27H31FN2O4 and a molecular weight of 466.55 g/mol. Its IUPAC name is 3-[cyclobutyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | 3-[cyclobutyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 69426695 |
| Molecular Formula | C27H31FN2O4 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 3-[cyclobutyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | COc1cccc2c(CCCCN(C3CCC3)C3COc4c(F)ccc(C(N)=O)c4C3)coc12 |
| InChI | InChI=1S/C27H31FN2O4/c1-32-24-10-5-9-20-17(15-33-26(20)24)6-2-3-13-30(18-7-4-8-18)19-14-22-21(27(29)31)11-12-23(28)25(22)34-16-19/h5,9-12,15,18-19H,2-4,6-8,13-14,16H2,1H3,(H2,29,31) |
| InChIKey | KRWUASQGUSTMLS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|