About N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine
N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine (PubChem CID 69426768) has the molecular formula C13H25NSi
and a molecular weight of 223.44 g/mol. Its IUPAC name is N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine |
| PubChem CID | 69426768 |
| Molecular Formula | C13H25NSi |
| Molecular Weight | 223.44 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(C(C)C)[Si](C)(C)C1=CC=CC1 |
| InChI | InChI=1S/C13H25NSi/c1-11(2)14(12(3)4)15(5,6)13-9-7-8-10-13/h7-9,11-12H,10H2,1-6H3 |
| InChIKey | IJAUKHOUXRQGSH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine?
The IUPAC name of N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine (CID 69426768) is N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine.
What is the SMILES notation for N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine?
The canonical SMILES for N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine is CC(C)N(C(C)C)[Si](C)(C)C1=CC=CC1.
What is the InChIKey of N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine?
The InChIKey is IJAUKHOUXRQGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NSi/c1-11(2)14(12(3)4)15(5,6)13-9-7-8-10-13/h7-9,11-12H,10H2,1-6H3.
What are the key properties of N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine?
N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine has a molecular weight of 223.44 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopenta-1,3-dien-1-yl(dimethyl)silyl]-N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 69426768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).