About thiazinane-3,4-diol
thiazinane-3,4-diol (PubChem CID 69426844) has the molecular formula C4H9NO2S
and a molecular weight of 135.19 g/mol. Its IUPAC name is thiazinane-3,4-diol.
Molecular Properties
| Compound Name | thiazinane-3,4-diol |
| PubChem CID | 69426844 |
| Molecular Formula | C4H9NO2S |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | thiazinane-3,4-diol |
| SMILES | OC1CCSNC1O |
| InChI | InChI=1S/C4H9NO2S/c6-3-1-2-8-5-4(3)7/h3-7H,1-2H2 |
| InChIKey | MFPXFRAWDLMKNQ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thiazinane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiazinane-3,4-diol?
The IUPAC name of thiazinane-3,4-diol (CID 69426844) is thiazinane-3,4-diol.
What is the SMILES notation for thiazinane-3,4-diol?
The canonical SMILES for thiazinane-3,4-diol is OC1CCSNC1O.
What is the InChIKey of thiazinane-3,4-diol?
The InChIKey is MFPXFRAWDLMKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2S/c6-3-1-2-8-5-4(3)7/h3-7H,1-2H2.
What are the key properties of thiazinane-3,4-diol?
thiazinane-3,4-diol has a molecular weight of 135.19 g/mol, XLogP of -0.69, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiazinane-3,4-diol is sourced from PubChem (CID 69426844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).