About 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine
4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine (PubChem CID 69427691) has the molecular formula C13H18ClIN2
and a molecular weight of 364.66 g/mol. Its IUPAC name is 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine |
| PubChem CID | 69427691 |
| Molecular Formula | C13H18ClIN2 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine |
| SMILES | CN(C)C.Cn1cc(CI)c2c(Cl)cccc21 |
| InChI | InChI=1S/C10H9ClIN.C3H9N/c1-13-6-7(5-12)10-8(11)3-2-4-9(10)13;1-4(2)3/h2-4,6H,5H2,1H3;1-3H3 |
| InChIKey | IDJKBNWLCNOTBN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine?
The IUPAC name of 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine (CID 69427691) is 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine.
What is the SMILES notation for 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine?
The canonical SMILES for 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine is CN(C)C.Cn1cc(CI)c2c(Cl)cccc21.
What is the InChIKey of 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine?
The InChIKey is IDJKBNWLCNOTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClIN.C3H9N/c1-13-6-7(5-12)10-8(11)3-2-4-9(10)13;1-4(2)3/h2-4,6H,5H2,1H3;1-3H3.
What are the key properties of 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine?
4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine has a molecular weight of 364.66 g/mol, XLogP of 3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(iodomethyl)-1-methylindole;N,N-dimethylmethanamine is sourced from PubChem (CID 69427691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).