C18H22F3NO3 — CID 69427718
tert-butyl (2S)-4-methylidene-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate (PubChem CID 69427718) has the molecular formula C18H22F3NO3 and a molecular weight of 357.37 g/mol. Its IUPAC name is tert-butyl (2S)-4-methylidene-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-methylidene-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69427718 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | tert-butyl (2S)-4-methylidene-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
| SMILES | C=C1C[C@@H](COCc2cc(F)c(F)cc2F)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H22F3NO3/c1-11-5-13(22(8-11)17(23)25-18(2,3)4)10-24-9-12-6-15(20)16(21)7-14(12)19/h6-7,13H,1,5,8-10H2,2-4H3/t13-/m0/s1 |
| InChIKey | WFLGLBNNEOIPPD-ZDUSSCGKSA-N |
| XLogP | 4.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|