About 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene
4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene (PubChem CID 69427838) has the molecular formula C13H11F
and a molecular weight of 186.23 g/mol. Its IUPAC name is 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene.
Molecular Properties
| Compound Name | 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene |
| PubChem CID | 69427838 |
| Molecular Formula | C13H11F |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene |
| SMILES | FC1=C2C=CCC2Cc2ccccc21 |
| InChI | InChI=1S/C13H11F/c14-13-11-6-2-1-4-9(11)8-10-5-3-7-12(10)13/h1-4,6-7,10H,5,8H2 |
| InChIKey | UFAWPBDRXXTDLI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene?
The IUPAC name of 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene (CID 69427838) is 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene.
What is the SMILES notation for 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene?
The canonical SMILES for 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene is FC1=C2C=CCC2Cc2ccccc21.
What is the InChIKey of 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene?
The InChIKey is UFAWPBDRXXTDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F/c14-13-11-6-2-1-4-9(11)8-10-5-3-7-12(10)13/h1-4,6-7,10H,5,8H2.
What are the key properties of 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene?
4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene has a molecular weight of 186.23 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-9,9a-dihydro-1H-cyclopenta[b]naphthalene is sourced from PubChem (CID 69427838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).