C37H39F3N2O2S — CID 69428390
(2S,4R)-N-butyl-N-methyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide (PubChem CID 69428390) has the molecular formula C37H39F3N2O2S and a molecular weight of 632.79 g/mol. Its IUPAC name is (2S,4R)-N-butyl-N-methyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide.
| Compound Name | (2S,4R)-N-butyl-N-methyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 69428390 |
| Molecular Formula | C37H39F3N2O2S |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | (2S,4R)-N-butyl-N-methyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxamide |
| SMILES | CCCCN(C)C(=O)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C37H39F3N2O2S/c1-3-4-20-41(2)36(43)42-24-32(22-31(42)26-44-25-27-21-34(39)35(40)23-33(27)38)45-37(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-19,21,23,31-32H,3-4,20,22,24-26H2,1-2H3/t31-,32+/m0/s1 |
| InChIKey | QKRRUNXFECXJKR-AJQTZOPKSA-N |
| XLogP | 8.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|