C25H29FN2O4 — CID 69428548
3-[ethyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 69428548) has the molecular formula C25H29FN2O4 and a molecular weight of 440.52 g/mol. Its IUPAC name is 3-[ethyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | 3-[ethyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 69428548 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-[ethyl-[4-(7-methoxy-1-benzofuran-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | CCN(CCCCc1coc2c(OC)cccc12)C1COc2c(F)ccc(C(N)=O)c2C1 |
| InChI | InChI=1S/C25H29FN2O4/c1-3-28(17-13-20-19(25(27)29)10-11-21(26)23(20)32-15-17)12-5-4-7-16-14-31-24-18(16)8-6-9-22(24)30-2/h6,8-11,14,17H,3-5,7,12-13,15H2,1-2H3,(H2,27,29) |
| InChIKey | GGAABGJJYNZFDV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|