About 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile
3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile (PubChem CID 69428603) has the molecular formula C21H19NO
and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile.
Molecular Properties
| Compound Name | 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile |
| PubChem CID | 69428603 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile |
| SMILES | Cc1ccc2c(c1)C(C)(C)CC2=C(C#N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19NO/c1-14-9-10-16-17(12-21(2,3)19(16)11-14)18(13-22)20(23)15-7-5-4-6-8-15/h4-11H,12H2,1-3H3 |
| InChIKey | PZSUXMIEMWRZBK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile?
The IUPAC name of 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile (CID 69428603) is 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile.
What is the SMILES notation for 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile?
The canonical SMILES for 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile is Cc1ccc2c(c1)C(C)(C)CC2=C(C#N)C(=O)c1ccccc1.
What is the InChIKey of 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile?
The InChIKey is PZSUXMIEMWRZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO/c1-14-9-10-16-17(12-21(2,3)19(16)11-14)18(13-22)20(23)15-7-5-4-6-8-15/h4-11H,12H2,1-3H3.
What are the key properties of 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile?
3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile has a molecular weight of 301.39 g/mol, XLogP of 4.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-3-phenyl-2-(3,3,5-trimethyl-2H-inden-1-ylidene)propanenitrile is sourced from PubChem (CID 69428603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).