About 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane
4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane (PubChem CID 69429134) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane.
Molecular Properties
| Compound Name | 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane |
| PubChem CID | 69429134 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C1CN2CC3OCCOC3CC2CN1 |
| InChI | InChI=1S/C10H18N2O2/c1-2-12-7-10-9(13-3-4-14-10)5-8(12)6-11-1/h8-11H,1-7H2 |
| InChIKey | VBJXGFXMWSRQFX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane?
The IUPAC name of 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane (CID 69429134) is 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane.
What is the SMILES notation for 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane?
The canonical SMILES for 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane is C1CN2CC3OCCOC3CC2CN1.
What is the InChIKey of 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane?
The InChIKey is VBJXGFXMWSRQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-2-12-7-10-9(13-3-4-14-10)5-8(12)6-11-1/h8-11H,1-7H2.
What are the key properties of 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane?
4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane has a molecular weight of 198.27 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dioxa-1,12-diazatricyclo[8.4.0.03,8]tetradecane is sourced from PubChem (CID 69429134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).