C36H34F3NO5S — CID 69429425
(2-ethoxy-2-oxoethyl) (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate (PubChem CID 69429425) has the molecular formula C36H34F3NO5S and a molecular weight of 649.73 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate.
| Compound Name | (2-ethoxy-2-oxoethyl) (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69429425 |
| Molecular Formula | C36H34F3NO5S |
| Molecular Weight | 649.73 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) (2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)COC(=O)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C36H34F3NO5S/c1-2-44-34(41)24-45-35(42)40-21-30(19-29(40)23-43-22-25-18-32(38)33(39)20-31(25)37)46-36(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-18,20,29-30H,2,19,21-24H2,1H3/t29-,30+/m0/s1 |
| InChIKey | IDTIAJCUIRXZBS-XZWHSSHBSA-N |
| XLogP | 7.49 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.73 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|