About 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine
4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine (PubChem CID 69429823) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine.
Molecular Properties
| Compound Name | 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine |
| PubChem CID | 69429823 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine |
| SMILES | CC#CCOc1cc(O[C@@H]2CCCC[C@@H]2C)ncn1 |
| InChI | InChI=1S/C15H20N2O2/c1-3-4-9-18-14-10-15(17-11-16-14)19-13-8-6-5-7-12(13)2/h10-13H,5-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | CEBXOKKMKYFKQI-QWHCGFSZSA-N |
| XLogP | 2.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine?
The IUPAC name of 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine (CID 69429823) is 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine.
What is the SMILES notation for 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine?
The canonical SMILES for 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine is CC#CCOc1cc(O[C@@H]2CCCC[C@@H]2C)ncn1.
What is the InChIKey of 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine?
The InChIKey is CEBXOKKMKYFKQI-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-3-4-9-18-14-10-15(17-11-16-14)19-13-8-6-5-7-12(13)2/h10-13H,5-9H2,1-2H3/t12-,13+/m0/s1.
What are the key properties of 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine?
4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine has a molecular weight of 260.34 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-ynoxy-6-[(1R,2S)-2-methylcyclohexyl]oxypyrimidine is sourced from PubChem (CID 69429823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).