C39H45ClN2O7 — CID 69429968
4-(3-chlorophenyl)-5-(2-cyanoethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]-3-(3,3-diphenylpropyl)-6-methylpiperidine-3,5-dicarboxylic acid (PubChem CID 69429968) has the molecular formula C39H45ClN2O7 and a molecular weight of 689.25 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(2-cyanoethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]-3-(3,3-diphenylpropyl)-6-methylpiperidine-3,5-dicarboxylic acid.
| Compound Name | 4-(3-chlorophenyl)-5-(2-cyanoethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]-3-(3,3-diphenylpropyl)-6-methylpiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 69429968 |
| Molecular Formula | C39H45ClN2O7 |
| Molecular Weight | 689.25 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(2-cyanoethyl)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxymethyl]-3-(3,3-diphenylpropyl)-6-methylpiperidine-3,5-dicarboxylic acid |
| SMILES | CC1NC(COCC2COC(C)(C)O2)C(CCC(c2ccccc2)c2ccccc2)(C(=O)O)C(c2cccc(Cl)c2)C1(CCC#N)C(=O)O |
| InChI | InChI=1S/C39H45ClN2O7/c1-26-38(35(43)44,19-11-21-41)34(29-16-10-17-30(40)22-29)39(36(45)46,33(42-26)25-47-23-31-24-48-37(2,3)49-31)20-18-32(27-12-6-4-7-13-27)28-14-8-5-9-15-28/h4-10,12-17,22,26,31-34,42H,11,18-20,23-25H2,1-3H3,(H,43,44)(H,45,46) |
| InChIKey | GBAHNPVCTJYOPU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.25 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |