C36H35F3N2O2S — CID 69430562
pyrrolidin-1-yl-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]methanone (PubChem CID 69430562) has the molecular formula C36H35F3N2O2S and a molecular weight of 616.75 g/mol. Its IUPAC name is pyrrolidin-1-yl-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 69430562 |
| Molecular Formula | C36H35F3N2O2S |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | pyrrolidin-1-yl-[(2S,4R)-2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCCC1)N1C[C@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C36H35F3N2O2S/c37-32-22-34(39)33(38)20-26(32)24-43-25-30-21-31(23-41(30)35(42)40-18-10-11-19-40)44-36(27-12-4-1-5-13-27,28-14-6-2-7-15-28)29-16-8-3-9-17-29/h1-9,12-17,20,22,30-31H,10-11,18-19,21,23-25H2/t30-,31+/m0/s1 |
| InChIKey | LRDSMCMVACYKJN-IOWSJCHKSA-N |
| XLogP | 8.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|