C35H37NO4 — CID 69430664
2-[4-[2-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(3-methylphenyl)-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl]anilino]acetic acid (PubChem CID 69430664) has the molecular formula C35H37NO4 and a molecular weight of 535.68 g/mol. Its IUPAC name is 2-[4-[2-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(3-methylphenyl)-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl]anilino]acetic acid.
| Compound Name | 2-[4-[2-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(3-methylphenyl)-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl]anilino]acetic acid |
|---|---|
| PubChem CID | 69430664 |
| Molecular Formula | C35H37NO4 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 2-[4-[2-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(3-methylphenyl)-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl]anilino]acetic acid |
| SMILES | Cc1cccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#Cc3ccc(NCC(=O)O)cc3)[C@@H]3CCC4=CC(=O)CCC4=C32)c1 |
| InChI | InChI=1S/C35H37NO4/c1-22-4-3-5-24(18-22)30-20-34(2)31(29-12-8-25-19-27(37)11-13-28(25)33(29)30)15-17-35(34,40)16-14-23-6-9-26(10-7-23)36-21-32(38)39/h3-7,9-10,18-19,29-31,36,40H,8,11-13,15,17,20-21H2,1-2H3,(H,38,39)/t29-,30+,31-,34-,35-/m0/s1 |
| InChIKey | DWHPAAPJJKFMEC-WQQPUSSASA-N |
| XLogP | 6.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|