C19H22FN5O3 — CID 69430919
(7S,9aS)-2-(5-fluoropyrimidin-2-yl)-7-[(3-nitrophenoxy)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 69430919) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is (7S,9aS)-2-(5-fluoropyrimidin-2-yl)-7-[(3-nitrophenoxy)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (7S,9aS)-2-(5-fluoropyrimidin-2-yl)-7-[(3-nitrophenoxy)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 69430919 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (7S,9aS)-2-(5-fluoropyrimidin-2-yl)-7-[(3-nitrophenoxy)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | O=[N+]([O-])c1cccc(OC[C@H]2CC[C@H]3CN(c4ncc(F)cn4)CCN3C2)c1 |
| InChI | InChI=1S/C19H22FN5O3/c20-15-9-21-19(22-10-15)24-7-6-23-11-14(4-5-17(23)12-24)13-28-18-3-1-2-16(8-18)25(26)27/h1-3,8-10,14,17H,4-7,11-13H2/t14-,17-/m0/s1 |
| InChIKey | IZGLLETVZWPSTO-YOEHRIQHSA-N |
| XLogP | 2.50 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|