C22H39N3O3 — CID 69430999
(3R)-2-tert-butyl-6-cyclohexyl-3-[3-(propylaminomethyl)-1,2,4-oxadiazol-5-yl]hexanoic acid (PubChem CID 69430999) has the molecular formula C22H39N3O3 and a molecular weight of 393.57 g/mol. Its IUPAC name is (3R)-2-tert-butyl-6-cyclohexyl-3-[3-(propylaminomethyl)-1,2,4-oxadiazol-5-yl]hexanoic acid.
| Compound Name | (3R)-2-tert-butyl-6-cyclohexyl-3-[3-(propylaminomethyl)-1,2,4-oxadiazol-5-yl]hexanoic acid |
|---|---|
| PubChem CID | 69430999 |
| Molecular Formula | C22H39N3O3 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | (3R)-2-tert-butyl-6-cyclohexyl-3-[3-(propylaminomethyl)-1,2,4-oxadiazol-5-yl]hexanoic acid |
| SMILES | CCCNCc1noc([C@H](CCCC2CCCCC2)C(C(=O)O)C(C)(C)C)n1 |
| InChI | InChI=1S/C22H39N3O3/c1-5-14-23-15-18-24-20(28-25-18)17(19(21(26)27)22(2,3)4)13-9-12-16-10-7-6-8-11-16/h16-17,19,23H,5-15H2,1-4H3,(H,26,27)/t17-,19?/m1/s1 |
| InChIKey | BGFABBDHMOOIPM-DUSLRRAJSA-N |
| XLogP | 5.15 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|