About trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol
trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol (PubChem CID 69431106) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol |
| PubChem CID | 69431106 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C)([C@@H]1CCC[C@@H](O)C1)[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO3/c1-9(2,10(12)13)7-4-3-5-8(11)6-7/h7-8,11H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | WNGPHMOYADQVEJ-HTQZYQBOSA-N |
| XLogP | 1.59 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol?
The IUPAC name of trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol (CID 69431106) is trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol?
The canonical SMILES for trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol is CC(C)([C@@H]1CCC[C@@H](O)C1)[N+](=O)[O-].
What is the InChIKey of trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol?
The InChIKey is WNGPHMOYADQVEJ-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H17NO3/c1-9(2,10(12)13)7-4-3-5-8(11)6-7/h7-8,11H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol?
trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol has a molecular weight of 187.24 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3R)-3-(2-nitropropan-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 69431106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).